C25H30N2O6 — CID 123155418
1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate (PubChem CID 123155418) has the molecular formula C25H30N2O6 and a molecular weight of 454.52 g/mol. Its IUPAC name is 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate.
| Compound Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123155418 |
| Molecular Formula | C25H30N2O6 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 1,3-bis(2-methylprop-2-enoyloxy)propan-2-yl 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COC(=O)C(=C)C)OC(=O)C(C#N)=Cc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C25H30N2O6/c1-7-27(8-2)21-11-9-19(10-12-21)13-20(14-26)25(30)33-22(15-31-23(28)17(3)4)16-32-24(29)18(5)6/h9-13,22H,3,5,7-8,15-16H2,1-2,4,6H3 |
| InChIKey | FZNNSZYPKVNIEL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|