C34H34N4O6 — CID 123772182
ethyl 2-cyano-3-[4-[[4-[[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-(hydroxymethyl)anilino]methyl]phenyl]methyl-(hydroxymethyl)amino]phenyl]prop-2-enoate (PubChem CID 123772182) has the molecular formula C34H34N4O6 and a molecular weight of 594.67 g/mol. Its IUPAC name is ethyl 2-cyano-3-[4-[[4-[[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-(hydroxymethyl)anilino]methyl]phenyl]methyl-(hydroxymethyl)amino]phenyl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[4-[[4-[[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-(hydroxymethyl)anilino]methyl]phenyl]methyl-(hydroxymethyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123772182 |
| Molecular Formula | C34H34N4O6 |
| Molecular Weight | 594.67 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | ethyl 2-cyano-3-[4-[[4-[[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-(hydroxymethyl)anilino]methyl]phenyl]methyl-(hydroxymethyl)amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(N(CO)Cc2ccc(CN(CO)c3ccc(C=C(C#N)C(=O)OCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H34N4O6/c1-3-43-33(41)29(19-35)17-25-9-13-31(14-10-25)37(23-39)21-27-5-7-28(8-6-27)22-38(24-40)32-15-11-26(12-16-32)18-30(20-36)34(42)44-4-2/h5-18,39-40H,3-4,21-24H2,1-2H3 |
| InChIKey | YUFWOBVGEKMNFH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|