C39H36N4O4 — CID 123805797
ethyl 2-cyano-3-[4-[4-[[4-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]phenyl]methyl]-N-methylanilino]phenyl]prop-2-enoate (PubChem CID 123805797) has the molecular formula C39H36N4O4 and a molecular weight of 624.74 g/mol. Its IUPAC name is ethyl 2-cyano-3-[4-[4-[[4-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]phenyl]methyl]-N-methylanilino]phenyl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[4-[4-[[4-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]phenyl]methyl]-N-methylanilino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123805797 |
| Molecular Formula | C39H36N4O4 |
| Molecular Weight | 624.74 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | ethyl 2-cyano-3-[4-[4-[[4-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]phenyl]methyl]-N-methylanilino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(N(C)c2ccc(Cc3ccc(N(C)c4ccc(C=C(C#N)C(=O)OCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H36N4O4/c1-5-46-38(44)32(26-40)24-30-11-19-36(20-12-30)42(3)34-15-7-28(8-16-34)23-29-9-17-35(18-10-29)43(4)37-21-13-31(14-22-37)25-33(27-41)39(45)47-6-2/h7-22,24-25H,5-6,23H2,1-4H3 |
| InChIKey | YFWDJVZLUSTZAH-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.74 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|