C43H44N4O6 — CID 123404577
ethyl 2-cyano-3-[4-[2-[4-[[4-[2-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]ethoxy]phenyl]methyl]phenoxy]ethyl-methylamino]phenyl]prop-2-enoate (PubChem CID 123404577) has the molecular formula C43H44N4O6 and a molecular weight of 712.85 g/mol. Its IUPAC name is ethyl 2-cyano-3-[4-[2-[4-[[4-[2-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]ethoxy]phenyl]methyl]phenoxy]ethyl-methylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-[4-[2-[4-[[4-[2-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]ethoxy]phenyl]methyl]phenoxy]ethyl-methylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123404577 |
| Molecular Formula | C43H44N4O6 |
| Molecular Weight | 712.85 g/mol |
| Exact Mass | 712.33 |
| IUPAC Name | ethyl 2-cyano-3-[4-[2-[4-[[4-[2-[4-(2-cyano-3-ethoxy-3-oxoprop-1-enyl)-N-methylanilino]ethoxy]phenyl]methyl]phenoxy]ethyl-methylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(N(C)CCOc2ccc(Cc3ccc(OCCN(C)c4ccc(C=C(C#N)C(=O)OCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C43H44N4O6/c1-5-50-42(48)36(30-44)28-34-7-15-38(16-8-34)46(3)23-25-52-40-19-11-32(12-20-40)27-33-13-21-41(22-14-33)53-26-24-47(4)39-17-9-35(10-18-39)29-37(31-45)43(49)51-6-2/h7-22,28-29H,5-6,23-27H2,1-4H3 |
| InChIKey | JYQHFPDBUFSFKE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 125.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.85 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|