C40H38N2O12S2 — CID 158738129
2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoic acid;ethyl 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate (PubChem CID 158738129) has the molecular formula C40H38N2O12S2 and a molecular weight of 802.88 g/mol. Its IUPAC name is 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoic acid;ethyl 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate.
| Compound Name | 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoic acid;ethyl 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 158738129 |
| Molecular Formula | C40H38N2O12S2 |
| Molecular Weight | 802.88 g/mol |
| Exact Mass | 802.19 |
| IUPAC Name | 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoic acid;ethyl 2-cyano-3-[4-[2-(4-methylsulfonyloxyphenyl)ethoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1ccc(OCCc2ccc(OS(C)(=O)=O)cc2)cc1.CS(=O)(=O)Oc1ccc(CCOc2ccc(C=C(C#N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H21NO6S.C19H17NO6S/c1-3-26-21(23)18(15-22)14-17-6-8-19(9-7-17)27-13-12-16-4-10-20(11-5-16)28-29(2,24)25;1-27(23,24)26-18-8-2-14(3-9-18)10-11-25-17-6-4-15(5-7-17)12-16(13-20)19(21)22/h4-11,14H,3,12-13H2,1-2H3;2-9,12H,10-11H2,1H3,(H,21,22) |
| InChIKey | ILYCGXLNFDUCFF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 216.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.88 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|