C41H40N4O4 — CID 123934625
[4-[[4-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyphenyl]methyl]phenyl] 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate (PubChem CID 123934625) has the molecular formula C41H40N4O4 and a molecular weight of 652.80 g/mol. Its IUPAC name is [4-[[4-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyphenyl]methyl]phenyl] 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate.
| Compound Name | [4-[[4-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyphenyl]methyl]phenyl] 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123934625 |
| Molecular Formula | C41H40N4O4 |
| Molecular Weight | 652.80 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | [4-[[4-[2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]oxyphenyl]methyl]phenyl] 2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
| SMILES | CCN(CC)c1ccc(C=C(C#N)C(=O)Oc2ccc(Cc3ccc(OC(=O)C(C#N)=Cc4ccc(N(CC)CC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C41H40N4O4/c1-5-44(6-2)36-17-9-32(10-18-36)26-34(28-42)40(46)48-38-21-13-30(14-22-38)25-31-15-23-39(24-16-31)49-41(47)35(29-43)27-33-11-19-37(20-12-33)45(7-3)8-4/h9-24,26-27H,5-8,25H2,1-4H3 |
| InChIKey | QKGGKAQSLLVLIJ-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 106.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.80 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|