C16H20N2O2 — CID 728728
ethyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate (PubChem CID 728728) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 728728 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C16H20N2O2/c1-4-18(5-2)15-9-7-13(8-10-15)11-14(12-17)16(19)20-6-3/h7-11H,4-6H2,1-3H3/b14-11+ |
| InChIKey | JFMVGZQLOXGKFR-SDNWHVSQSA-N |
| XLogP | 3.00 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|