C26H22N4O6 — CID 6304333
ethyl (E)-2-cyano-3-[4-[[2-[4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoacetyl]amino]phenyl]prop-2-enoate (PubChem CID 6304333) has the molecular formula C26H22N4O6 and a molecular weight of 486.48 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[[2-[4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoacetyl]amino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[[2-[4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoacetyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6304333 |
| Molecular Formula | C26H22N4O6 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[[2-[4-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]anilino]-2-oxoacetyl]amino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(NC(=O)C(=O)Nc2ccc(/C=C(\C#N)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C26H22N4O6/c1-3-35-25(33)19(15-27)13-17-5-9-21(10-6-17)29-23(31)24(32)30-22-11-7-18(8-12-22)14-20(16-28)26(34)36-4-2/h5-14H,3-4H2,1-2H3,(H,29,31)(H,30,32)/b19-13+,20-14+ |
| InChIKey | NQLJCBXTFZAWOC-IWGRKNQJSA-N |
| XLogP | 3.20 |
| TPSA | 158.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|