C18H12N2O4 — CID 157179628
ethyl (Z)-2-cyano-3-[4-[(E)-2-cyano-5-hydroxy-3-oxopent-1-en-4-ynyl]phenyl]prop-2-enoate (PubChem CID 157179628) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is ethyl (Z)-2-cyano-3-[4-[(E)-2-cyano-5-hydroxy-3-oxopent-1-en-4-ynyl]phenyl]prop-2-enoate.
| Compound Name | ethyl (Z)-2-cyano-3-[4-[(E)-2-cyano-5-hydroxy-3-oxopent-1-en-4-ynyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 157179628 |
| Molecular Formula | C18H12N2O4 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | ethyl (Z)-2-cyano-3-[4-[(E)-2-cyano-5-hydroxy-3-oxopent-1-en-4-ynyl]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C\c1ccc(/C=C(\C#N)C(=O)C#CO)cc1 |
| InChI | InChI=1S/C18H12N2O4/c1-2-24-18(23)16(12-20)10-14-5-3-13(4-6-14)9-15(11-19)17(22)7-8-21/h3-6,9-10,21H,2H2,1H3/b15-9+,16-10- |
| InChIKey | KCOYBQRFRULTHL-TYVLLQCESA-N |
| XLogP | 1.97 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|