C22H24N2O4S — CID 25331502
ethyl (E)-2-cyano-3-[4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenyl]prop-2-enoate (PubChem CID 25331502) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 25331502 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | ethyl (E)-2-cyano-3-[4-[(2,3,5,6-tetramethylphenyl)sulfonylamino]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccc(NS(=O)(=O)c2c(C)c(C)cc(C)c2C)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-6-28-22(25)19(13-23)12-18-7-9-20(10-8-18)24-29(26,27)21-16(4)14(2)11-15(3)17(21)5/h7-12,24H,6H2,1-5H3/b19-12+ |
| InChIKey | JLMSCAVHFZQHKC-XDHOZWIPSA-N |
| XLogP | 4.19 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|