C16H19NO2 — CID 678466
ethyl 2-cyano-3-(2,3,5,6-tetramethylphenyl)prop-2-enoate (PubChem CID 678466) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is ethyl 2-cyano-3-(2,3,5,6-tetramethylphenyl)prop-2-enoate.
| Compound Name | ethyl 2-cyano-3-(2,3,5,6-tetramethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 678466 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | ethyl 2-cyano-3-(2,3,5,6-tetramethylphenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(C#N)=Cc1c(C)c(C)cc(C)c1C |
| InChI | InChI=1S/C16H19NO2/c1-6-19-16(18)14(9-17)8-15-12(4)10(2)7-11(3)13(15)5/h7-8H,6H2,1-5H3 |
| InChIKey | VLMDCIXNTCMZIR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|