C11H11NO2 — CID 153334352
ethyl (E)-2-cyano-3-cyclopenta-1,3-dien-1-ylprop-2-enoate (PubChem CID 153334352) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-cyclopenta-1,3-dien-1-ylprop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-cyclopenta-1,3-dien-1-ylprop-2-enoate |
|---|---|
| PubChem CID | 153334352 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | ethyl (E)-2-cyano-3-cyclopenta-1,3-dien-1-ylprop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/C1=CC=CC1 |
| InChI | InChI=1S/C11H11NO2/c1-2-14-11(13)10(8-12)7-9-5-3-4-6-9/h3-5,7H,2,6H2,1H3/b10-7+ |
| InChIKey | KYKLCPWEGNBTCD-JXMROGBWSA-N |
| XLogP | 1.89 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|