C15H17NO5 — CID 6515913
ethyl (E)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 6515913) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6515913 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | ethyl (E)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C15H17NO5/c1-5-21-15(17)11(9-16)6-10-7-13(19-3)14(20-4)8-12(10)18-2/h6-8H,5H2,1-4H3/b11-6+ |
| InChIKey | JNRMJRJOIFQHGX-IZZDOVSWSA-N |
| XLogP | 2.18 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|