C13H14N2O3S — CID 845659
(Z)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enethioamide (PubChem CID 845659) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enethioamide.
| Compound Name | (Z)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enethioamide |
|---|---|
| PubChem CID | 845659 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (Z)-2-cyano-3-(2,4,5-trimethoxyphenyl)prop-2-enethioamide |
| SMILES | COc1cc(OC)c(OC)cc1/C=C(/C#N)C(N)=S |
| InChI | InChI=1S/C13H14N2O3S/c1-16-10-6-12(18-3)11(17-2)5-8(10)4-9(7-14)13(15)19/h4-6H,1-3H3,(H2,15,19)/b9-4- |
| InChIKey | MOVGBOLFDPXJAS-WTKPLQERSA-N |
| XLogP | 1.91 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|