C11H9BrN2O2S — CID 2236689
(E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyanoprop-2-enethioamide (PubChem CID 2236689) has the molecular formula C11H9BrN2O2S and a molecular weight of 313.18 g/mol. Its IUPAC name is (E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyanoprop-2-enethioamide.
| Compound Name | (E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 2236689 |
| Molecular Formula | C11H9BrN2O2S |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | (E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyanoprop-2-enethioamide |
| SMILES | COc1cc(/C=C(\C#N)C(N)=S)c(Br)cc1O |
| InChI | InChI=1S/C11H9BrN2O2S/c1-16-10-3-6(8(12)4-9(10)15)2-7(5-13)11(14)17/h2-4,15H,1H3,(H2,14,17)/b7-2+ |
| InChIKey | AGFFNKLNKWSGSU-FARCUNLSSA-N |
| XLogP | 2.36 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|