C18H15BrN2O4 — CID 2714293
(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 2714293) has the molecular formula C18H15BrN2O4 and a molecular weight of 403.23 g/mol. Its IUPAC name is (E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2714293 |
| Molecular Formula | C18H15BrN2O4 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | (E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2cc(O)c(OC)cc2Br)cc1 |
| InChI | InChI=1S/C18H15BrN2O4/c1-24-14-5-3-13(4-6-14)21-18(23)12(10-20)7-11-8-16(22)17(25-2)9-15(11)19/h3-9,22H,1-2H3,(H,21,23)/b12-7+ |
| InChIKey | KQOOAZLKABXPJT-KPKJPENVSA-N |
| XLogP | 3.72 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|