C19H17BrN2O3 — CID 99923418
(E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 99923418) has the molecular formula C19H17BrN2O3 and a molecular weight of 401.26 g/mol. Its IUPAC name is (E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 99923418 |
| Molecular Formula | C19H17BrN2O3 |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | (E)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-cyano-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccc(C)cc2C)c(Br)cc1O |
| InChI | InChI=1S/C19H17BrN2O3/c1-11-4-5-16(12(2)6-11)22-19(24)14(10-21)7-13-8-18(25-3)17(23)9-15(13)20/h4-9,23H,1-3H3,(H,22,24)/b14-7+ |
| InChIKey | GNTPSYPFWOIGTE-VGOFMYFVSA-N |
| XLogP | 4.33 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|