C20H19BrN2O3 — CID 7967398
(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 7967398) has the molecular formula C20H19BrN2O3 and a molecular weight of 415.29 g/mol. Its IUPAC name is (E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7967398 |
| Molecular Formula | C20H19BrN2O3 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | (E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(Br)c(/C=C(\C#N)C(=O)Nc2c(C)cc(C)cc2C)cc1O |
| InChI | InChI=1S/C20H19BrN2O3/c1-11-5-12(2)19(13(3)6-11)23-20(25)15(10-22)7-14-8-17(24)18(26-4)9-16(14)21/h5-9,24H,1-4H3,(H,23,25)/b15-7+ |
| InChIKey | CMQDAAZPXLNCEK-VIZOYTHASA-N |
| XLogP | 4.63 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|