C18H14BrFN2O3 — CID 7909185
(E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide (PubChem CID 7909185) has the molecular formula C18H14BrFN2O3 and a molecular weight of 405.22 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7909185 |
| Molecular Formula | C18H14BrFN2O3 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)-2-cyano-N-(4-fluorophenyl)prop-2-enamide |
| SMILES | COc1cc(Br)c(/C=C(\C#N)C(=O)Nc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C18H14BrFN2O3/c1-24-16-8-11(15(19)9-17(16)25-2)7-12(10-21)18(23)22-14-5-3-13(20)4-6-14/h3-9H,1-2H3,(H,22,23)/b12-7+ |
| InChIKey | APODCMOHVHALIR-KPKJPENVSA-N |
| XLogP | 4.15 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|