C18H14Br2N2O2 — CID 2262674
(Z)-2-cyano-3-(3,5-dibromo-2-hydroxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 2262674) has the molecular formula C18H14Br2N2O2 and a molecular weight of 450.13 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dibromo-2-hydroxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dibromo-2-hydroxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2262674 |
| Molecular Formula | C18H14Br2N2O2 |
| Molecular Weight | 450.13 g/mol |
| Exact Mass | 447.94 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dibromo-2-hydroxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2cc(Br)cc(Br)c2O)c(C)c1 |
| InChI | InChI=1S/C18H14Br2N2O2/c1-10-3-4-16(11(2)5-10)22-18(24)13(9-21)6-12-7-14(19)8-15(20)17(12)23/h3-8,23H,1-2H3,(H,22,24)/b13-6- |
| InChIKey | MSGPRSWVHYGSLB-MLPAPPSSSA-N |
| XLogP | 5.08 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.13 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|