C20H17N2O4- — CID 2261855
5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-methoxybenzoate (PubChem CID 2261855) has the molecular formula C20H17N2O4- and a molecular weight of 349.37 g/mol. Its IUPAC name is 5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-methoxybenzoate.
| Compound Name | 5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 2261855 |
| Molecular Formula | C20H17N2O4- |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 5-[(Z)-2-cyano-3-(2,4-dimethylanilino)-3-oxoprop-1-enyl]-2-methoxybenzoate |
| SMILES | COc1ccc(/C=C(/C#N)C(=O)Nc2ccc(C)cc2C)cc1C(=O)[O-] |
| InChI | InChI=1S/C20H18N2O4/c1-12-4-6-17(13(2)8-12)22-19(23)15(11-21)9-14-5-7-18(26-3)16(10-14)20(24)25/h4-10H,1-3H3,(H,22,23)(H,24,25)/p-1/b15-9- |
| InChIKey | GCAGWRYMOIWQCK-DHDCSXOGSA-M |
| XLogP | 2.22 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|