C19H17ClN2O2 — CID 4245723
3-(3-chloro-4-methoxyphenyl)-2-cyano-N-(2,5-dimethylphenyl)prop-2-enamide (PubChem CID 4245723) has the molecular formula C19H17ClN2O2 and a molecular weight of 340.81 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-2-cyano-N-(2,5-dimethylphenyl)prop-2-enamide.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-2-cyano-N-(2,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4245723 |
| Molecular Formula | C19H17ClN2O2 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-2-cyano-N-(2,5-dimethylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C=C(C#N)C(=O)Nc2cc(C)ccc2C)cc1Cl |
| InChI | InChI=1S/C19H17ClN2O2/c1-12-4-5-13(2)17(8-12)22-19(23)15(11-21)9-14-6-7-18(24-3)16(20)10-14/h4-10H,1-3H3,(H,22,23) |
| InChIKey | HYSOOEQEKCCYIQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|