C19H16Br2N2O2 — CID 94846074
(E)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide (PubChem CID 94846074) has the molecular formula C19H16Br2N2O2 and a molecular weight of 464.16 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94846074 |
| Molecular Formula | C19H16Br2N2O2 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | (E)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(2,5-dimethylphenyl)prop-2-enamide |
| SMILES | COc1c(Br)cc(/C=C(\C#N)C(=O)Nc2cc(C)ccc2C)cc1Br |
| InChI | InChI=1S/C19H16Br2N2O2/c1-11-4-5-12(2)17(6-11)23-19(24)14(10-22)7-13-8-15(20)18(25-3)16(21)9-13/h4-9H,1-3H3,(H,23,24)/b14-7+ |
| InChIKey | WSRYJTJAWXTHNX-VGOFMYFVSA-N |
| XLogP | 5.38 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|