C19H16BrClN2O4 — CID 17267194
(E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide (PubChem CID 17267194) has the molecular formula C19H16BrClN2O4 and a molecular weight of 451.70 g/mol. Its IUPAC name is (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 17267194 |
| Molecular Formula | C19H16BrClN2O4 |
| Molecular Weight | 451.70 g/mol |
| Exact Mass | 450.00 |
| IUPAC Name | (E)-3-(3-bromo-4,5-dimethoxyphenyl)-N-(5-chloro-2-methoxyphenyl)-2-cyanoprop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)/C(C#N)=C/c1cc(Br)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H16BrClN2O4/c1-25-16-5-4-13(21)9-15(16)23-19(24)12(10-22)6-11-7-14(20)18(27-3)17(8-11)26-2/h4-9H,1-3H3,(H,23,24)/b12-6+ |
| InChIKey | NLFBCGKNZXFEMA-WUXMJOGZSA-N |
| XLogP | 4.67 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.70 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|