C17H11Br2N3O4 — CID 20834842
(Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(4-nitrophenyl)prop-2-enamide (PubChem CID 20834842) has the molecular formula C17H11Br2N3O4 and a molecular weight of 481.10 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 20834842 |
| Molecular Formula | C17H11Br2N3O4 |
| Molecular Weight | 481.10 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dibromo-4-methoxyphenyl)-N-(4-nitrophenyl)prop-2-enamide |
| SMILES | COc1c(Br)cc(/C=C(/C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C17H11Br2N3O4/c1-26-16-14(18)7-10(8-15(16)19)6-11(9-20)17(23)21-12-2-4-13(5-3-12)22(24)25/h2-8H,1H3,(H,21,23)/b11-6- |
| InChIKey | HBMYOXKUCSKDFL-WDZFZDKYSA-N |
| XLogP | 4.67 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.10 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|