C17H12BrN3O4 — CID 94843173
(Z)-3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-methylphenyl)prop-2-enamide (PubChem CID 94843173) has the molecular formula C17H12BrN3O4 and a molecular weight of 402.20 g/mol. Its IUPAC name is (Z)-3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 94843173 |
| Molecular Formula | C17H12BrN3O4 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | (Z)-3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\c2cc(Br)c(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C17H12BrN3O4/c1-10-2-4-13(5-3-10)20-17(23)12(9-19)6-11-7-14(18)16(22)15(8-11)21(24)25/h2-8,22H,1H3,(H,20,23)/b12-6- |
| InChIKey | BYBFPBPIMVGSEN-SDQBBNPISA-N |
| XLogP | 3.92 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|