C18H14BrN3O5 — CID 3545065
3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 3545065) has the molecular formula C18H14BrN3O5 and a molecular weight of 432.23 g/mol. Its IUPAC name is 3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | 3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3545065 |
| Molecular Formula | C18H14BrN3O5 |
| Molecular Weight | 432.23 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 3-(3-bromo-4-hydroxy-5-nitrophenyl)-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)C(C#N)=Cc2cc(Br)c(O)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H14BrN3O5/c1-2-27-14-5-3-13(4-6-14)21-18(24)12(10-20)7-11-8-15(19)17(23)16(9-11)22(25)26/h3-9,23H,2H2,1H3,(H,21,24) |
| InChIKey | KHUXIODLPPIKRG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|