C24H19N3O4S — CID 6032535
(E)-2-cyano-N-(4-methoxyphenyl)-3-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]prop-2-enamide (PubChem CID 6032535) has the molecular formula C24H19N3O4S and a molecular weight of 445.50 g/mol. Its IUPAC name is (E)-2-cyano-N-(4-methoxyphenyl)-3-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4-methoxyphenyl)-3-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6032535 |
| Molecular Formula | C24H19N3O4S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (E)-2-cyano-N-(4-methoxyphenyl)-3-[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C/c2ccc(Sc3ccc(C)cc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H19N3O4S/c1-16-3-10-21(11-4-16)32-23-12-5-17(14-22(23)27(29)30)13-18(15-25)24(28)26-19-6-8-20(31-2)9-7-19/h3-14H,1-2H3,(H,26,28)/b18-13+ |
| InChIKey | FIPYDYSYFJNVKF-QGOAFFKASA-N |
| XLogP | 5.61 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|