C23H16ClN3O4S — CID 5210051
3-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 5210051) has the molecular formula C23H16ClN3O4S and a molecular weight of 465.92 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | 3-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 5210051 |
| Molecular Formula | C23H16ClN3O4S |
| Molecular Weight | 465.92 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 3-[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]-2-cyano-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)C(C#N)=Cc2ccc(Sc3ccc(Cl)cc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H16ClN3O4S/c1-31-19-7-5-18(6-8-19)26-23(28)16(14-25)12-15-2-11-22(21(13-15)27(29)30)32-20-9-3-17(24)4-10-20/h2-13H,1H3,(H,26,28) |
| InChIKey | XGKVODUKMUATKY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.92 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|