C26H19N5O4S — CID 92953465
(Z)-2-cyano-3-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]-N-(4-phenoxyphenyl)prop-2-enamide (PubChem CID 92953465) has the molecular formula C26H19N5O4S and a molecular weight of 497.54 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]-N-(4-phenoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]-N-(4-phenoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 92953465 |
| Molecular Formula | C26H19N5O4S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | (Z)-2-cyano-3-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]-N-(4-phenoxyphenyl)prop-2-enamide |
| SMILES | Cn1ccnc1Sc1ccc(/C=C(/C#N)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H19N5O4S/c1-30-14-13-28-26(30)36-24-12-7-18(16-23(24)31(33)34)15-19(17-27)25(32)29-20-8-10-22(11-9-20)35-21-5-3-2-4-6-21/h2-16H,1H3,(H,29,32)/b19-15- |
| InChIKey | LEJSFNYDWHANEA-CYVLTUHYSA-N |
| XLogP | 5.82 |
| TPSA | 123.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|