C22H17N5O4S — CID 5435293
3-hydroxy-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]naphthalene-2-carboxamide (PubChem CID 5435293) has the molecular formula C22H17N5O4S and a molecular weight of 447.48 g/mol. Its IUPAC name is 3-hydroxy-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]naphthalene-2-carboxamide.
| Compound Name | 3-hydroxy-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 5435293 |
| Molecular Formula | C22H17N5O4S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 3-hydroxy-N-[(Z)-[4-(1-methylimidazol-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]naphthalene-2-carboxamide |
| SMILES | Cn1ccnc1Sc1ccc(/C=N\NC(=O)c2cc3ccccc3cc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17N5O4S/c1-26-9-8-23-22(26)32-20-7-6-14(10-18(20)27(30)31)13-24-25-21(29)17-11-15-4-2-3-5-16(15)12-19(17)28/h2-13,28H,1H3,(H,25,29)/b24-13- |
| InChIKey | VKHHAILVLOWOQI-CFRMEGHHSA-N |
| XLogP | 4.10 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_acyl_naphthol(22)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|