C20H14N6O3S — CID 6892795
N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-indole-3-carboxamide (PubChem CID 6892795) has the molecular formula C20H14N6O3S and a molecular weight of 418.44 g/mol. Its IUPAC name is N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 6892795 |
| Molecular Formula | C20H14N6O3S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]-1H-indole-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2ncccn2)c([N+](=O)[O-])c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H14N6O3S/c27-19(15-12-23-16-5-2-1-4-14(15)16)25-24-11-13-6-7-18(17(10-13)26(28)29)30-20-21-8-3-9-22-20/h1-12,23H,(H,25,27)/b24-11+ |
| InChIKey | OGEQKIOIGBRUKT-BHGWPJFGSA-N |
| XLogP | 3.78 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|