C25H17Cl2N5O4S — CID 19657702
2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide (PubChem CID 19657702) has the molecular formula C25H17Cl2N5O4S and a molecular weight of 554.42 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 19657702 |
| Molecular Formula | C25H17Cl2N5O4S |
| Molecular Weight | 554.42 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(3-nitro-4-pyrimidin-2-ylsulfanylphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(Sc2ncccn2)c([N+](=O)[O-])c1)c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H17Cl2N5O4S/c26-18-8-7-17(20(27)13-18)15-36-22-5-2-1-4-19(22)24(33)31-30-14-16-6-9-23(21(12-16)32(34)35)37-25-28-10-3-11-29-25/h1-14H,15H2,(H,31,33)/b30-14+ |
| InChIKey | VCOIXAZNLLRRCA-AMVVHIIESA-N |
| XLogP | 6.19 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|