C25H23Cl2N3O2 — CID 19657691
2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide (PubChem CID 19657691) has the molecular formula C25H23Cl2N3O2 and a molecular weight of 468.38 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 19657691 |
| Molecular Formula | C25H23Cl2N3O2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]-N-[(E)-(4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C/c1ccc(N2CCCC2)cc1)c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H23Cl2N3O2/c26-20-10-9-19(23(27)15-20)17-32-24-6-2-1-5-22(24)25(31)29-28-16-18-7-11-21(12-8-18)30-13-3-4-14-30/h1-2,5-12,15-16H,3-4,13-14,17H2,(H,29,31)/b28-16+ |
| InChIKey | UVMXVMREVMQEDC-LQKURTRISA-N |
| XLogP | 5.94 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|