C25H17BrCl2N2O3 — CID 19657477
N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide (PubChem CID 19657477) has the molecular formula C25H17BrCl2N2O3 and a molecular weight of 544.23 g/mol. Its IUPAC name is N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide.
| Compound Name | N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide |
|---|---|
| PubChem CID | 19657477 |
| Molecular Formula | C25H17BrCl2N2O3 |
| Molecular Weight | 544.23 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | N-[(E)-[5-(4-bromophenyl)furan-2-yl]methylideneamino]-2-[(2,4-dichlorophenyl)methoxy]benzamide |
| SMILES | O=C(N/N=C/c1ccc(-c2ccc(Br)cc2)o1)c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C25H17BrCl2N2O3/c26-18-8-5-16(6-9-18)23-12-11-20(33-23)14-29-30-25(31)21-3-1-2-4-24(21)32-15-17-7-10-19(27)13-22(17)28/h1-14H,15H2,(H,30,31)/b29-14+ |
| InChIKey | QNCMOOPDLROTBZ-IPPBACCNSA-N |
| XLogP | 7.36 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.23 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|