C26H19ClN2O5 — CID 19657386
4-[5-[(E)-[[2-[(2-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 19657386) has the molecular formula C26H19ClN2O5 and a molecular weight of 474.90 g/mol. Its IUPAC name is 4-[5-[(E)-[[2-[(2-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[(E)-[[2-[(2-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 19657386 |
| Molecular Formula | C26H19ClN2O5 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.10 |
| IUPAC Name | 4-[5-[(E)-[[2-[(2-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(/C=N/NC(=O)c3ccccc3OCc3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C26H19ClN2O5/c27-22-7-3-1-5-19(22)16-33-24-8-4-2-6-21(24)25(30)29-28-15-20-13-14-23(34-20)17-9-11-18(12-10-17)26(31)32/h1-15H,16H2,(H,29,30)(H,31,32)/b28-15+ |
| InChIKey | HKXJILYQJMLJRD-RWPZCVJISA-N |
| XLogP | 5.64 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|