C19H15FN2O3 — CID 3439847
N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methoxybenzamide (PubChem CID 3439847) has the molecular formula C19H15FN2O3 and a molecular weight of 338.34 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 3439847 |
| Molecular Formula | C19H15FN2O3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NN=Cc1ccc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C19H15FN2O3/c1-24-18-5-3-2-4-16(18)19(23)22-21-12-15-10-11-17(25-15)13-6-8-14(20)9-7-13/h2-12H,1H3,(H,22,23) |
| InChIKey | XYWCDTUIUVJUPT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|