C20H17ClN2O4 — CID 6109398
N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 6109398) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6109398 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[(Z)-[5-(4-chlorophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(-c3ccc(Cl)cc3)o2)c(OC)c1 |
| InChI | InChI=1S/C20H17ClN2O4/c1-25-15-7-9-17(19(11-15)26-2)20(24)23-22-12-16-8-10-18(27-16)13-3-5-14(21)6-4-13/h3-12H,1-2H3,(H,23,24)/b22-12- |
| InChIKey | VHJJUOOYCFMDRI-UUYOSTAYSA-N |
| XLogP | 4.38 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|