C21H18N2O6 — CID 3385327
3-[5-[[(2,4-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 3385327) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-[5-[[(2,4-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[[(2,4-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3385327 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-[5-[[(2,4-dimethoxybenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COc1ccc(C(=O)NN=Cc2ccc(-c3cccc(C(=O)O)c3)o2)c(OC)c1 |
| InChI | InChI=1S/C21H18N2O6/c1-27-15-6-8-17(19(11-15)28-2)20(24)23-22-12-16-7-9-18(29-16)13-4-3-5-14(10-13)21(25)26/h3-12H,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | GAYDKWKIGKOBTD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|