C20H16BrN3O6 — CID 6055073
N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide (PubChem CID 6055073) has the molecular formula C20H16BrN3O6 and a molecular weight of 474.27 g/mol. Its IUPAC name is N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6055073 |
| Molecular Formula | C20H16BrN3O6 |
| Molecular Weight | 474.27 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | N-[(Z)-[5-(4-bromo-2-nitrophenyl)furan-2-yl]methylideneamino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(-c3ccc(Br)cc3[N+](=O)[O-])o2)c(OC)c1 |
| InChI | InChI=1S/C20H16BrN3O6/c1-28-13-4-7-16(19(10-13)29-2)20(25)23-22-11-14-5-8-18(30-14)15-6-3-12(21)9-17(15)24(26)27/h3-11H,1-2H3,(H,23,25)/b22-11- |
| InChIKey | NGFGWJKOTHCQLR-JJFYIABZSA-N |
| XLogP | 4.40 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|