C19H14BrN3O6 — CID 126397426
N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide (PubChem CID 126397426) has the molecular formula C19H14BrN3O6 and a molecular weight of 460.24 g/mol. Its IUPAC name is N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 126397426 |
| Molecular Formula | C19H14BrN3O6 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | N-[(Z)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2ccc(-c3ccc([N+](=O)[O-])cc3Br)o2)c(O)c1 |
| InChI | InChI=1S/C19H14BrN3O6/c1-28-12-3-6-15(17(24)9-12)19(25)22-21-10-13-4-7-18(29-13)14-5-2-11(23(26)27)8-16(14)20/h2-10,24H,1H3,(H,22,25)/b21-10- |
| InChIKey | STCMNJLFLCWMKA-FBHDLOMBSA-N |
| XLogP | 4.10 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|