C18H11BrN4O7 — CID 96892341
N-[(E)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide (PubChem CID 96892341) has the molecular formula C18H11BrN4O7 and a molecular weight of 475.21 g/mol. Its IUPAC name is N-[(E)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide.
| Compound Name | N-[(E)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 96892341 |
| Molecular Formula | C18H11BrN4O7 |
| Molecular Weight | 475.21 g/mol |
| Exact Mass | 473.98 |
| IUPAC Name | N-[(E)-[5-(2-bromo-4-nitrophenyl)furan-2-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
| SMILES | O=C(N/N=C/c1ccc(-c2ccc([N+](=O)[O-])cc2Br)o1)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C18H11BrN4O7/c19-15-8-11(23(28)29)1-4-13(15)17-6-3-12(30-17)9-20-21-18(25)14-7-10(22(26)27)2-5-16(14)24/h1-9,24H,(H,21,25)/b20-9+ |
| InChIKey | IITUVRSWWDBCHG-AWQFTUOYSA-N |
| XLogP | 3.99 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|