C19H12ClN3O7 — CID 126053844
2-chloro-5-[5-[(Z)-[(2-hydroxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126053844) has the molecular formula C19H12ClN3O7 and a molecular weight of 429.77 g/mol. Its IUPAC name is 2-chloro-5-[5-[(Z)-[(2-hydroxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[(Z)-[(2-hydroxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126053844 |
| Molecular Formula | C19H12ClN3O7 |
| Molecular Weight | 429.77 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2-chloro-5-[5-[(Z)-[(2-hydroxy-5-nitrobenzoyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(N/N=C\c1ccc(-c2ccc(Cl)c(C(=O)O)c2)o1)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C19H12ClN3O7/c20-15-4-1-10(7-13(15)19(26)27)17-6-3-12(30-17)9-21-22-18(25)14-8-11(23(28)29)2-5-16(14)24/h1-9,24H,(H,22,25)(H,26,27)/b21-9- |
| InChIKey | OOPZKNFDKMVPKS-NKVSQWTQSA-N |
| XLogP | 3.68 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|