C17H11ClN4O5 — CID 2880979
2-chloro-5-[5-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 2880979) has the molecular formula C17H11ClN4O5 and a molecular weight of 386.75 g/mol. Its IUPAC name is 2-chloro-5-[5-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-5-[5-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 2880979 |
| Molecular Formula | C17H11ClN4O5 |
| Molecular Weight | 386.75 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-chloro-5-[5-[[(5-nitro-2-pyridinyl)hydrazinylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(C=NNc3ccc([N+](=O)[O-])cn3)o2)ccc1Cl |
| InChI | InChI=1S/C17H11ClN4O5/c18-14-4-1-10(7-13(14)17(23)24)15-5-3-12(27-15)9-20-21-16-6-2-11(8-19-16)22(25)26/h1-9H,(H,19,21)(H,23,24) |
| InChIKey | OWKUHKATGLRDHZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|