C20H15ClN2O5 — CID 58586325
5-[(2E)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-methylbenzoic acid (PubChem CID 58586325) has the molecular formula C20H15ClN2O5 and a molecular weight of 398.80 g/mol. Its IUPAC name is 5-[(2E)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-methylbenzoic acid.
| Compound Name | 5-[(2E)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 58586325 |
| Molecular Formula | C20H15ClN2O5 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 5-[(2E)-2-[[5-(3-carboxy-4-chlorophenyl)furan-2-yl]methylidene]hydrazinyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(N/N=C/c2ccc(-c3ccc(Cl)c(C(=O)O)c3)o2)cc1C(=O)O |
| InChI | InChI=1S/C20H15ClN2O5/c1-11-2-4-13(9-15(11)19(24)25)23-22-10-14-5-7-18(28-14)12-3-6-17(21)16(8-12)20(26)27/h2-10,23H,1H3,(H,24,25)(H,26,27)/b22-10+ |
| InChIKey | RXBQFSMXOQNQEA-LSHDLFTRSA-N |
| XLogP | 4.75 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|