C20H17BrClN3O2 — CID 126351374
2-(4-bromoanilino)-N-[(Z)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126351374) has the molecular formula C20H17BrClN3O2 and a molecular weight of 446.73 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(Z)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[(Z)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126351374 |
| Molecular Formula | C20H17BrClN3O2 |
| Molecular Weight | 446.73 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(Z)-[5-(3-chloro-4-methylphenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | Cc1ccc(-c2ccc(/C=N\NC(=O)CNc3ccc(Br)cc3)o2)cc1Cl |
| InChI | InChI=1S/C20H17BrClN3O2/c1-13-2-3-14(10-18(13)22)19-9-8-17(27-19)11-24-25-20(26)12-23-16-6-4-15(21)5-7-16/h2-11,23H,12H2,1H3,(H,25,26)/b24-11- |
| InChIKey | ILSLJRMKLHPRJP-MYKKPKGFSA-N |
| XLogP | 5.23 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|