C19H14Cl2IN3O2 — CID 126088985
N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 126088985) has the molecular formula C19H14Cl2IN3O2 and a molecular weight of 514.15 g/mol. Its IUPAC name is N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 126088985 |
| Molecular Formula | C19H14Cl2IN3O2 |
| Molecular Weight | 514.15 g/mol |
| Exact Mass | 512.95 |
| IUPAC Name | N-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | O=C(CNc1ccc(I)cc1)N/N=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H14Cl2IN3O2/c20-16-7-1-12(9-17(16)21)18-8-6-15(27-18)10-24-25-19(26)11-23-14-4-2-13(22)3-5-14/h1-10,23H,11H2,(H,25,26)/b24-10- |
| InChIKey | QKLUNSZEJJDMKM-VROXFSQNSA-N |
| XLogP | 5.42 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.15 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|