C22H19Cl2N3O3 — CID 94837559
N'-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-phenylethyl)propanediamide (PubChem CID 94837559) has the molecular formula C22H19Cl2N3O3 and a molecular weight of 444.32 g/mol. Its IUPAC name is N'-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-phenylethyl)propanediamide.
| Compound Name | N'-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 94837559 |
| Molecular Formula | C22H19Cl2N3O3 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | N'-[(Z)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-phenylethyl)propanediamide |
| SMILES | O=C(CC(=O)N/N=C\c1ccc(-c2ccc(Cl)c(Cl)c2)o1)NCCc1ccccc1 |
| InChI | InChI=1S/C22H19Cl2N3O3/c23-18-8-6-16(12-19(18)24)20-9-7-17(30-20)14-26-27-22(29)13-21(28)25-11-10-15-4-2-1-3-5-15/h1-9,12,14H,10-11,13H2,(H,25,28)(H,27,29)/b26-14- |
| InChIKey | OMBGAUZVDJKWSK-WGARJPEWSA-N |
| XLogP | 4.45 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|