C21H17Cl2N3O4 — CID 94837533
N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-ethoxyphenyl)oxamide (PubChem CID 94837533) has the molecular formula C21H17Cl2N3O4 and a molecular weight of 446.29 g/mol. Its IUPAC name is N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-ethoxyphenyl)oxamide.
| Compound Name | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-ethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 94837533 |
| Molecular Formula | C21H17Cl2N3O4 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2-ethoxyphenyl)oxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N/N=C/c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C21H17Cl2N3O4/c1-2-29-19-6-4-3-5-17(19)25-20(27)21(28)26-24-12-14-8-10-18(30-14)13-7-9-15(22)16(23)11-13/h3-12H,2H2,1H3,(H,25,27)(H,26,28)/b24-12+ |
| InChIKey | WLAIQXBZQKLHIO-WYMPLXKRSA-N |
| XLogP | 4.74 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|