C21H17Cl2N3O5 — CID 94837523
N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2,5-dimethoxyphenyl)oxamide (PubChem CID 94837523) has the molecular formula C21H17Cl2N3O5 and a molecular weight of 462.29 g/mol. Its IUPAC name is N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2,5-dimethoxyphenyl)oxamide.
| Compound Name | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2,5-dimethoxyphenyl)oxamide |
|---|---|
| PubChem CID | 94837523 |
| Molecular Formula | C21H17Cl2N3O5 |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N'-[(E)-[5-(3,4-dichlorophenyl)furan-2-yl]methylideneamino]-N-(2,5-dimethoxyphenyl)oxamide |
| SMILES | COc1ccc(OC)c(NC(=O)C(=O)N/N=C/c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1 |
| InChI | InChI=1S/C21H17Cl2N3O5/c1-29-13-4-8-19(30-2)17(10-13)25-20(27)21(28)26-24-11-14-5-7-18(31-14)12-3-6-15(22)16(23)9-12/h3-11H,1-2H3,(H,25,27)(H,26,28)/b24-11+ |
| InChIKey | AQWMFUUEQBKEFS-BHGWPJFGSA-N |
| XLogP | 4.36 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|